About 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine
2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine (PubChem CID 66572348) has the molecular formula C22H21Cl2NS
and a molecular weight of 402.39 g/mol. Its IUPAC name is 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine.
Molecular Properties
| Compound Name | 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine |
| PubChem CID | 66572348 |
| Molecular Formula | C22H21Cl2NS |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine |
| SMILES | NCCSC(Cc1ccccc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21Cl2NS/c23-20-10-6-18(7-11-20)22(26-15-14-25,16-17-4-2-1-3-5-17)19-8-12-21(24)13-9-19/h1-13H,14-16,25H2 |
| InChIKey | TVCXBVNVLLPBID-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine?
The IUPAC name of 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine (CID 66572348) is 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine.
What is the SMILES notation for 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine?
The canonical SMILES for 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine is NCCSC(Cc1ccccc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1.
What is the InChIKey of 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine?
The InChIKey is TVCXBVNVLLPBID-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21Cl2NS/c23-20-10-6-18(7-11-20)22(26-15-14-25,16-17-4-2-1-3-5-17)19-8-12-21(24)13-9-19/h1-13H,14-16,25H2.
What are the key properties of 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine?
2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine has a molecular weight of 402.39 g/mol, XLogP of 6.17, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,1-bis(4-chlorophenyl)-2-phenylethyl]sulfanylethanamine is sourced from PubChem (CID 66572348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).