About 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol
4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol (PubChem CID 66572397) has the molecular formula C21H25Cl2NO2
and a molecular weight of 394.34 g/mol. Its IUPAC name is 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol |
| PubChem CID | 66572397 |
| Molecular Formula | C21H25Cl2NO2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol |
| SMILES | OC(CCN1CCC(O)(Cc2ccccc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H25Cl2NO2/c22-18-7-6-17(14-19(18)23)20(25)8-11-24-12-9-21(26,10-13-24)15-16-4-2-1-3-5-16/h1-7,14,20,25-26H,8-13,15H2 |
| InChIKey | JZHYJRPFUZJBQH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol?
The IUPAC name of 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol (CID 66572397) is 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol.
What is the SMILES notation for 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol?
The canonical SMILES for 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol is OC(CCN1CCC(O)(Cc2ccccc2)CC1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol?
The InChIKey is JZHYJRPFUZJBQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25Cl2NO2/c22-18-7-6-17(14-19(18)23)20(25)8-11-24-12-9-21(26,10-13-24)15-16-4-2-1-3-5-16/h1-7,14,20,25-26H,8-13,15H2.
What are the key properties of 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol?
4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol has a molecular weight of 394.34 g/mol, XLogP of 4.49, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-ol is sourced from PubChem (CID 66572397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).