C21H23Cl2NO — CID 66572510
(1S,2S)-2-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(3,4-dichlorophenyl)propan-1-ol (PubChem CID 66572510) has the molecular formula C21H23Cl2NO and a molecular weight of 376.33 g/mol. Its IUPAC name is (1S,2S)-2-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(3,4-dichlorophenyl)propan-1-ol.
| Compound Name | (1S,2S)-2-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(3,4-dichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 66572510 |
| Molecular Formula | C21H23Cl2NO |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (1S,2S)-2-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(3,4-dichlorophenyl)propan-1-ol |
| SMILES | C[C@@H]([C@@H](O)c1ccc(Cl)c(Cl)c1)N1CC=C(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23Cl2NO/c1-15(21(25)18-7-8-19(22)20(23)14-18)24-11-9-17(10-12-24)13-16-5-3-2-4-6-16/h2-9,14-15,21,25H,10-13H2,1H3/t15-,21+/m0/s1 |
| InChIKey | BLVOPMLJPLEJNF-YCRPNKLZSA-N |
| XLogP | 5.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|