C26H29FN8O — CID 66572580
2-N-[(E)-[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methylideneamino]-4-N-(3-morpholin-4-ylpropyl)quinazoline-2,4-diamine (PubChem CID 66572580) has the molecular formula C26H29FN8O and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-N-[(E)-[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methylideneamino]-4-N-(3-morpholin-4-ylpropyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-[(E)-[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methylideneamino]-4-N-(3-morpholin-4-ylpropyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 66572580 |
| Molecular Formula | C26H29FN8O |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 2-N-[(E)-[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methylideneamino]-4-N-(3-morpholin-4-ylpropyl)quinazoline-2,4-diamine |
| SMILES | Fc1ccc(Cn2ccnc2/C=N/Nc2nc(NCCCN3CCOCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H29FN8O/c27-21-8-6-20(7-9-21)19-35-13-11-28-24(35)18-30-33-26-31-23-5-2-1-4-22(23)25(32-26)29-10-3-12-34-14-16-36-17-15-34/h1-2,4-9,11,13,18H,3,10,12,14-17,19H2,(H2,29,31,32,33)/b30-18+ |
| InChIKey | KFNKYWURBLNAOP-UXHLAJHPSA-N |
| XLogP | 3.59 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|