C26H30N8O — CID 66572656
2-N-[(E)-(1-benzylimidazol-2-yl)methylideneamino]-4-N-(3-morpholin-4-ylpropyl)quinazoline-2,4-diamine (PubChem CID 66572656) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is 2-N-[(E)-(1-benzylimidazol-2-yl)methylideneamino]-4-N-(3-morpholin-4-ylpropyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-[(E)-(1-benzylimidazol-2-yl)methylideneamino]-4-N-(3-morpholin-4-ylpropyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 66572656 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-N-[(E)-(1-benzylimidazol-2-yl)methylideneamino]-4-N-(3-morpholin-4-ylpropyl)quinazoline-2,4-diamine |
| SMILES | C(=N/Nc1nc(NCCCN2CCOCC2)c2ccccc2n1)\c1nccn1Cc1ccccc1 |
| InChI | InChI=1S/C26H30N8O/c1-2-7-21(8-3-1)20-34-14-12-27-24(34)19-29-32-26-30-23-10-5-4-9-22(23)25(31-26)28-11-6-13-33-15-17-35-18-16-33/h1-5,7-10,12,14,19H,6,11,13,15-18,20H2,(H2,28,30,31,32)/b29-19+ |
| InChIKey | DQEYXIUVJLJZQV-VUTHCHCSSA-N |
| XLogP | 3.45 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|