About gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane
gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane (PubChem CID 66572930) has the molecular formula C13H9AuF3O6PS
and a molecular weight of 578.21 g/mol. Its IUPAC name is gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane.
Molecular Properties
| Compound Name | gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane |
| PubChem CID | 66572930 |
| Molecular Formula | C13H9AuF3O6PS |
| Molecular Weight | 578.21 g/mol |
| Exact Mass | 577.95 |
| IUPAC Name | gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane |
| SMILES | O=S(=O)([O-])C(F)(F)F.[Au+].c1coc(P(c2ccco2)c2ccco2)c1 |
| InChI | InChI=1S/C12H9O3P.CHF3O3S.Au/c1-4-10(13-7-1)16(11-5-2-8-14-11)12-6-3-9-15-12;2-1(3,4)8(5,6)7;/h1-9H;(H,5,6,7);/q;;+1/p-1 |
| InChIKey | IVDUSEGWAHKLOU-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 96.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 578.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane?
The IUPAC name of gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane (CID 66572930) is gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane.
What is the SMILES notation for gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane?
The canonical SMILES for gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane is O=S(=O)([O-])C(F)(F)F.[Au+].c1coc(P(c2ccco2)c2ccco2)c1.
What is the InChIKey of gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane?
The InChIKey is IVDUSEGWAHKLOU-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H9O3P.CHF3O3S.Au/c1-4-10(13-7-1)16(11-5-2-8-14-11)12-6-3-9-15-12;2-1(3,4)8(5,6)7;/h1-9H;(H,5,6,7);/q;;+1/p-1.
What are the key properties of gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane?
gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane has a molecular weight of 578.21 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);trifluoromethanesulfonate;tris(furan-2-yl)phosphane is sourced from PubChem (CID 66572930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).