About methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate
methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate (PubChem CID 66573071) has the molecular formula C13H8F4N2O4
and a molecular weight of 332.21 g/mol. Its IUPAC name is methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate |
| PubChem CID | 66573071 |
| Molecular Formula | C13H8F4N2O4 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate |
| SMILES | COC(=O)c1c(C(F)(F)F)[nH]n(-c2ccc(F)cc2)c(=O)c1=O |
| InChI | InChI=1S/C13H8F4N2O4/c1-23-12(22)8-9(20)11(21)19(18-10(8)13(15,16)17)7-4-2-6(14)3-5-7/h2-5,18H,1H3 |
| InChIKey | ULTAAKQGWXRJPO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate?
The IUPAC name of methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate (CID 66573071) is methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate.
What is the SMILES notation for methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate?
The canonical SMILES for methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate is COC(=O)c1c(C(F)(F)F)[nH]n(-c2ccc(F)cc2)c(=O)c1=O.
What is the InChIKey of methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate?
The InChIKey is ULTAAKQGWXRJPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F4N2O4/c1-23-12(22)8-9(20)11(21)19(18-10(8)13(15,16)17)7-4-2-6(14)3-5-7/h2-5,18H,1H3.
What are the key properties of methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate?
methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate has a molecular weight of 332.21 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-fluorophenyl)-3,4-dioxo-6-(trifluoromethyl)-1H-pyridazine-5-carboxylate is sourced from PubChem (CID 66573071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).