About 1-benzyl-1,2-dihydrophthalazine
1-benzyl-1,2-dihydrophthalazine (PubChem CID 66573450) has the molecular formula C15H14N2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-benzyl-1,2-dihydrophthalazine.
Molecular Properties
| Compound Name | 1-benzyl-1,2-dihydrophthalazine |
| PubChem CID | 66573450 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-benzyl-1,2-dihydrophthalazine |
| SMILES | C1=NNC(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C15H14N2/c1-2-6-12(7-3-1)10-15-14-9-5-4-8-13(14)11-16-17-15/h1-9,11,15,17H,10H2 |
| InChIKey | MXLOUOCGWZNAET-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-1,2-dihydrophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1,2-dihydrophthalazine?
The IUPAC name of 1-benzyl-1,2-dihydrophthalazine (CID 66573450) is 1-benzyl-1,2-dihydrophthalazine.
What is the SMILES notation for 1-benzyl-1,2-dihydrophthalazine?
The canonical SMILES for 1-benzyl-1,2-dihydrophthalazine is C1=NNC(Cc2ccccc2)c2ccccc21.
What is the InChIKey of 1-benzyl-1,2-dihydrophthalazine?
The InChIKey is MXLOUOCGWZNAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2/c1-2-6-12(7-3-1)10-15-14-9-5-4-8-13(14)11-16-17-15/h1-9,11,15,17H,10H2.
What are the key properties of 1-benzyl-1,2-dihydrophthalazine?
1-benzyl-1,2-dihydrophthalazine has a molecular weight of 222.29 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1,2-dihydrophthalazine is sourced from PubChem (CID 66573450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).