C22H31N3O10S — CID 66573906
methyl (2R,3R,4S)-3-acetamido-4-(cyclopropylcarbamothioylamino)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 66573906) has the molecular formula C22H31N3O10S and a molecular weight of 529.57 g/mol. Its IUPAC name is methyl (2R,3R,4S)-3-acetamido-4-(cyclopropylcarbamothioylamino)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-3-acetamido-4-(cyclopropylcarbamothioylamino)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 66573906 |
| Molecular Formula | C22H31N3O10S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | methyl (2R,3R,4S)-3-acetamido-4-(cyclopropylcarbamothioylamino)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](NC(=S)NC2CC2)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C22H31N3O10S/c1-10(26)23-18-15(25-22(36)24-14-6-7-14)8-16(21(30)31-5)35-20(18)19(34-13(4)29)17(33-12(3)28)9-32-11(2)27/h8,14-15,17-20H,6-7,9H2,1-5H3,(H,23,26)(H2,24,25,36)/t15-,17+,18+,19+,20+/m0/s1 |
| InChIKey | SYAKIGRCQQUBKO-CJSSEVFESA-N |
| XLogP | -0.63 |
| TPSA | 167.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|