C16H27N3O7S — CID 66574218
(2R,3R,4S)-3-acetamido-4-(butylcarbamothioylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 66574218) has the molecular formula C16H27N3O7S and a molecular weight of 405.47 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-(butylcarbamothioylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-(butylcarbamothioylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 66574218 |
| Molecular Formula | C16H27N3O7S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-(butylcarbamothioylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCCNC(=S)N[C@H]1C=C(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C16H27N3O7S/c1-3-4-5-17-16(27)19-9-6-11(15(24)25)26-14(12(9)18-8(2)21)13(23)10(22)7-20/h6,9-10,12-14,20,22-23H,3-5,7H2,1-2H3,(H,18,21)(H,24,25)(H2,17,19,27)/t9-,10+,12+,13+,14+/m0/s1 |
| InChIKey | KZXSWIMYIVIGRQ-NRFQWKTPSA-N |
| XLogP | -1.79 |
| TPSA | 160.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|