C25H31NO3 — CID 66574393
(8R,9S,10R,13S,14S,17R)-4,17-dihydroxy-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 66574393) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-4,17-dihydroxy-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17R)-4,17-dihydroxy-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 66574393 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-4,17-dihydroxy-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C(O)=C1C=C[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)Cc1ccccn1 |
| InChI | InChI=1S/C25H31NO3/c1-23-11-10-21(27)22(28)20(23)7-6-17-18(23)8-12-24(2)19(17)9-13-25(24,29)15-16-5-3-4-14-26-16/h3-7,14,17-19,28-29H,8-13,15H2,1-2H3/t17-,18+,19+,23-,24+,25-/m1/s1 |
| InChIKey | LKACDWSGXOFVOT-XQSOFYKVSA-N |
| XLogP | 4.55 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |