C19H13ClN4O — CID 66574540
4-chloro-2-[(4-methoxyphenyl)methyl]pyrazolo[3,4-c]quinoline-8-carbonitrile (PubChem CID 66574540) has the molecular formula C19H13ClN4O and a molecular weight of 348.79 g/mol. Its IUPAC name is 4-chloro-2-[(4-methoxyphenyl)methyl]pyrazolo[3,4-c]quinoline-8-carbonitrile.
| Compound Name | 4-chloro-2-[(4-methoxyphenyl)methyl]pyrazolo[3,4-c]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 66574540 |
| Molecular Formula | C19H13ClN4O |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-chloro-2-[(4-methoxyphenyl)methyl]pyrazolo[3,4-c]quinoline-8-carbonitrile |
| SMILES | COc1ccc(Cn2cc3c(n2)c(Cl)nc2ccc(C#N)cc23)cc1 |
| InChI | InChI=1S/C19H13ClN4O/c1-25-14-5-2-12(3-6-14)10-24-11-16-15-8-13(9-21)4-7-17(15)22-19(20)18(16)23-24/h2-8,11H,10H2,1H3 |
| InChIKey | FSEQPPRZXLUNKA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|