About 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide
3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide (PubChem CID 66574936) has the molecular formula C19H15BrF2N2O4
and a molecular weight of 453.24 g/mol. Its IUPAC name is 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide |
| PubChem CID | 66574936 |
| Molecular Formula | C19H15BrF2N2O4 |
| Molecular Weight | 453.24 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide |
| SMILES | COc1ccc(-c2nc([C@H](C)Oc3ccc(F)c(C(N)=O)c3F)oc2Br)cc1 |
| InChI | InChI=1S/C19H15BrF2N2O4/c1-9(27-13-8-7-12(21)14(15(13)22)18(23)25)19-24-16(17(20)28-19)10-3-5-11(26-2)6-4-10/h3-9H,1-2H3,(H2,23,25)/t9-/m0/s1 |
| InChIKey | QTCXEJTWWFWZOH-VIFPVBQESA-N |
| XLogP | 4.63 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide?
The IUPAC name of 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide (CID 66574936) is 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide.
What is the SMILES notation for 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide?
The canonical SMILES for 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide is COc1ccc(-c2nc([C@H](C)Oc3ccc(F)c(C(N)=O)c3F)oc2Br)cc1.
What is the InChIKey of 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide?
The InChIKey is QTCXEJTWWFWZOH-VIFPVBQESA-N. The full InChI is InChI=1S/C19H15BrF2N2O4/c1-9(27-13-8-7-12(21)14(15(13)22)18(23)25)19-24-16(17(20)28-19)10-3-5-11(26-2)6-4-10/h3-9H,1-2H3,(H2,23,25)/t9-/m0/s1.
What are the key properties of 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide?
3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide has a molecular weight of 453.24 g/mol, XLogP of 4.63, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-1-[5-bromo-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]ethoxy]-2,6-difluorobenzamide is sourced from PubChem (CID 66574936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).