C26H48O3Si — CID 66575479
(3R)-3-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohex-3-en-1-yl]-1-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-ol (PubChem CID 66575479) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is (3R)-3-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohex-3-en-1-yl]-1-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-ol.
| Compound Name | (3R)-3-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohex-3-en-1-yl]-1-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 66575479 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | (3R)-3-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohex-3-en-1-yl]-1-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-ol |
| SMILES | CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]([C@@H](C)C(O)C[C@@H]2[C@@H](C)[C@]3(C)CC[C@@]2(C)O3)CC1 |
| InChI | InChI=1S/C26H48O3Si/c1-17-11-12-20(23(15-17)28-30(9,10)24(4,5)6)18(2)22(27)16-21-19(3)25(7)13-14-26(21,8)29-25/h15,18-23,27H,11-14,16H2,1-10H3/t18-,19-,20-,21-,22?,23-,25+,26-/m1/s1 |
| InChIKey | ZCXFETSKOORGRK-AYGZXURZSA-N |
| XLogP | 6.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|