About dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate)
dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate) (PubChem CID 66575567) has the molecular formula C24H20Cl4N4O6Sn
and a molecular weight of 720.97 g/mol. Its IUPAC name is dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate).
Molecular Properties
| Compound Name | dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate) |
| PubChem CID | 66575567 |
| Molecular Formula | C24H20Cl4N4O6Sn |
| Molecular Weight | 720.97 g/mol |
| Exact Mass | 719.92 |
| IUPAC Name | dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate) |
| SMILES | Cl[Sn+2]Cl.[H]/N=c1/c(C(=O)OCC)cc2cc(Cl)ccc2n1[O-].[H]/N=c1/c(C(=O)OCC)cc2cc(Cl)ccc2n1[O-] |
| InChI | InChI=1S/2C12H10ClN2O3.2ClH.Sn/c2*1-2-18-12(16)9-6-7-5-8(13)3-4-10(7)15(17)11(9)14;;;/h2*3-6,14H,2H2,1H3;2*1H;/q2*-1;;;+4/p-2/b2*14-11-;;; |
| InChIKey | RPTTWGCQUKCKIA-BGFMMZJESA-L |
| XLogP | 5.59 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 720.97 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate)?
The IUPAC name of dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate) (CID 66575567) is dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate).
What is the SMILES notation for dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate)?
The canonical SMILES for dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate) is Cl[Sn+2]Cl.[H]/N=c1/c(C(=O)OCC)cc2cc(Cl)ccc2n1[O-].[H]/N=c1/c(C(=O)OCC)cc2cc(Cl)ccc2n1[O-].
What is the InChIKey of dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate)?
The InChIKey is RPTTWGCQUKCKIA-BGFMMZJESA-L. The full InChI is InChI=1S/2C12H10ClN2O3.2ClH.Sn/c2*1-2-18-12(16)9-6-7-5-8(13)3-4-10(7)15(17)11(9)14;;;/h2*3-6,14H,2H2,1H3;2*1H;/q2*-1;;;+4/p-2/b2*14-11-;;;.
What are the key properties of dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate)?
dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate) has a molecular weight of 720.97 g/mol, XLogP of 5.59, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotin(2+);bis(ethyl 6-chloro-2-imino-1-oxidoquinoline-3-carboxylate) is sourced from PubChem (CID 66575567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).