C20H27N3O3S — CID 665757
(3R)-2,2-dimethyl-N-(3-morpholin-4-ylpropyl)-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 665757) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is (3R)-2,2-dimethyl-N-(3-morpholin-4-ylpropyl)-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | (3R)-2,2-dimethyl-N-(3-morpholin-4-ylpropyl)-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 665757 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (3R)-2,2-dimethyl-N-(3-morpholin-4-ylpropyl)-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | CC1(C)SC2c3ccccc3C(=O)N2[C@@H]1C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C20H27N3O3S/c1-20(2)16(17(24)21-8-5-9-22-10-12-26-13-11-22)23-18(25)14-6-3-4-7-15(14)19(23)27-20/h3-4,6-7,16,19H,5,8-13H2,1-2H3,(H,21,24)/t16-,19?/m1/s1 |
| InChIKey | NLMFMGJMZCYWSQ-VTBWFHPJSA-N |
| XLogP | 1.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|