C16H23N5O3 — CID 66575872
4-N-butyl-5-[(3,4-dimethoxy-2-pyridinyl)methoxy]pyrimidine-2,4-diamine (PubChem CID 66575872) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-N-butyl-5-[(3,4-dimethoxy-2-pyridinyl)methoxy]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-[(3,4-dimethoxy-2-pyridinyl)methoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66575872 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 4-N-butyl-5-[(3,4-dimethoxy-2-pyridinyl)methoxy]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)ncc1OCc1nccc(OC)c1OC |
| InChI | InChI=1S/C16H23N5O3/c1-4-5-7-19-15-13(9-20-16(17)21-15)24-10-11-14(23-3)12(22-2)6-8-18-11/h6,8-9H,4-5,7,10H2,1-3H3,(H3,17,19,20,21) |
| InChIKey | WATIQKNKFHABJQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|