About 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine
4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine (PubChem CID 66576806) has the molecular formula C19H15ClN4
and a molecular weight of 334.81 g/mol. Its IUPAC name is 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine.
Molecular Properties
| Compound Name | 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine |
| PubChem CID | 66576806 |
| Molecular Formula | C19H15ClN4 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine |
| SMILES | Cc1cccc(-c2nnc3c(c(-c4ccccc4)nn3C)c2Cl)c1 |
| InChI | InChI=1S/C19H15ClN4/c1-12-7-6-10-14(11-12)18-16(20)15-17(13-8-4-3-5-9-13)23-24(2)19(15)22-21-18/h3-11H,1-2H3 |
| InChIKey | DBIQYSPUXHMHGP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine?
The IUPAC name of 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine (CID 66576806) is 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine.
What is the SMILES notation for 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine?
The canonical SMILES for 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine is Cc1cccc(-c2nnc3c(c(-c4ccccc4)nn3C)c2Cl)c1.
What is the InChIKey of 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine?
The InChIKey is DBIQYSPUXHMHGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN4/c1-12-7-6-10-14(11-12)18-16(20)15-17(13-8-4-3-5-9-13)23-24(2)19(15)22-21-18/h3-11H,1-2H3.
What are the key properties of 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine?
4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine has a molecular weight of 334.81 g/mol, XLogP of 4.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-methyl-5-(3-methylphenyl)-3-phenylpyrazolo[3,4-c]pyridazine is sourced from PubChem (CID 66576806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).