C25H36O5Si — CID 66577095
methyl (3aR,4R,7S,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-4-phenylmethoxy-2,4,7,7a-tetrahydro-1H-indene-3a-carboxylate (PubChem CID 66577095) has the molecular formula C25H36O5Si and a molecular weight of 444.64 g/mol. Its IUPAC name is methyl (3aR,4R,7S,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-4-phenylmethoxy-2,4,7,7a-tetrahydro-1H-indene-3a-carboxylate.
| Compound Name | methyl (3aR,4R,7S,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-4-phenylmethoxy-2,4,7,7a-tetrahydro-1H-indene-3a-carboxylate |
|---|---|
| PubChem CID | 66577095 |
| Molecular Formula | C25H36O5Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | methyl (3aR,4R,7S,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-4-phenylmethoxy-2,4,7,7a-tetrahydro-1H-indene-3a-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)CC[C@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)C=C[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C25H36O5Si/c1-24(2,3)31(5,6)30-17-19-12-15-22(29-16-18-10-8-7-9-11-18)25(23(27)28-4)20(19)13-14-21(25)26/h7-12,15,19-20,22H,13-14,16-17H2,1-6H3/t19-,20+,22-,25+/m1/s1 |
| InChIKey | XNVRPQNKHQLYCM-GFMPLVLUSA-N |
| XLogP | 4.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|