C32H31Cl2NO4 — CID 66578381
2-[1-[4-[4-[4-[5-(3,4-dichlorophenyl)-5-hydroxypentyl]-3-methyl-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetic acid (PubChem CID 66578381) has the molecular formula C32H31Cl2NO4 and a molecular weight of 564.51 g/mol. Its IUPAC name is 2-[1-[4-[4-[4-[5-(3,4-dichlorophenyl)-5-hydroxypentyl]-3-methyl-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[4-[4-[4-[5-(3,4-dichlorophenyl)-5-hydroxypentyl]-3-methyl-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 66578381 |
| Molecular Formula | C32H31Cl2NO4 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | 2-[1-[4-[4-[4-[5-(3,4-dichlorophenyl)-5-hydroxypentyl]-3-methyl-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetic acid |
| SMILES | Cc1noc(-c2ccc(-c3ccc(C4(CC(=O)O)CC4)cc3)cc2)c1CCCCC(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H31Cl2NO4/c1-20-26(4-2-3-5-29(36)24-12-15-27(33)28(34)18-24)31(39-35-20)23-8-6-21(7-9-23)22-10-13-25(14-11-22)32(16-17-32)19-30(37)38/h6-15,18,29,36H,2-5,16-17,19H2,1H3,(H,37,38) |
| InChIKey | LEVKXVOCZQLCQB-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|