C34H33Cl2NO4 — CID 66578511
ethyl 2-[1-[4-[4-[4-[(E)-5-(3,4-dichlorophenyl)-5-hydroxypent-4-enyl]-3-methyl-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetate (PubChem CID 66578511) has the molecular formula C34H33Cl2NO4 and a molecular weight of 590.55 g/mol. Its IUPAC name is ethyl 2-[1-[4-[4-[4-[(E)-5-(3,4-dichlorophenyl)-5-hydroxypent-4-enyl]-3-methyl-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetate.
| Compound Name | ethyl 2-[1-[4-[4-[4-[(E)-5-(3,4-dichlorophenyl)-5-hydroxypent-4-enyl]-3-methyl-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 66578511 |
| Molecular Formula | C34H33Cl2NO4 |
| Molecular Weight | 590.55 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | ethyl 2-[1-[4-[4-[4-[(E)-5-(3,4-dichlorophenyl)-5-hydroxypent-4-enyl]-3-methyl-1,2-oxazol-5-yl]phenyl]phenyl]cyclopropyl]acetate |
| SMILES | CCOC(=O)CC1(c2ccc(-c3ccc(-c4onc(C)c4CCC/C=C(/O)c4ccc(Cl)c(Cl)c4)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H33Cl2NO4/c1-3-40-32(39)21-34(18-19-34)27-15-12-24(13-16-27)23-8-10-25(11-9-23)33-28(22(2)37-41-33)6-4-5-7-31(38)26-14-17-29(35)30(36)20-26/h7-17,20,38H,3-6,18-19,21H2,1-2H3/b31-7+ |
| InChIKey | BJDJUKLQGKOBIT-XSRQVHLBSA-N |
| XLogP | 9.53 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.55 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|