About [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate
[cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate (PubChem CID 66579195) has the molecular formula C14H17BN2O4
and a molecular weight of 288.11 g/mol. Its IUPAC name is [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate.
Molecular Properties
| Compound Name | [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate |
| PubChem CID | 66579195 |
| Molecular Formula | C14H17BN2O4 |
| Molecular Weight | 288.11 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate |
| SMILES | O=C(NC1CC1)OB(OC(=O)NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C14H17BN2O4/c18-13(16-11-6-7-11)20-15(10-4-2-1-3-5-10)21-14(19)17-12-8-9-12/h1-5,11-12H,6-9H2,(H,16,18)(H,17,19) |
| InChIKey | WGEOKKDZZYPOIO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.11 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate?
The IUPAC name of [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate (CID 66579195) is [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate.
What is the SMILES notation for [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate?
The canonical SMILES for [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate is O=C(NC1CC1)OB(OC(=O)NC1CC1)c1ccccc1.
What is the InChIKey of [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate?
The InChIKey is WGEOKKDZZYPOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BN2O4/c18-13(16-11-6-7-11)20-15(10-4-2-1-3-5-10)21-14(19)17-12-8-9-12/h1-5,11-12H,6-9H2,(H,16,18)(H,17,19).
What are the key properties of [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate?
[cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate has a molecular weight of 288.11 g/mol, XLogP of 1.16, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclopropylcarbamoyloxy(phenyl)boranyl] N-cyclopropylcarbamate is sourced from PubChem (CID 66579195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).