About 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane
6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane (PubChem CID 66579448) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane |
| PubChem CID | 66579448 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane |
| SMILES | C=CCC1COCCC12OCCO2 |
| InChI | InChI=1S/C10H16O3/c1-2-3-9-8-11-5-4-10(9)12-6-7-13-10/h2,9H,1,3-8H2 |
| InChIKey | AZDGWOTUSXKCRU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane?
The IUPAC name of 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane (CID 66579448) is 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane.
What is the SMILES notation for 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane?
The canonical SMILES for 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane is C=CCC1COCCC12OCCO2.
What is the InChIKey of 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane?
The InChIKey is AZDGWOTUSXKCRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-2-3-9-8-11-5-4-10(9)12-6-7-13-10/h2,9H,1,3-8H2.
What are the key properties of 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane?
6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane has a molecular weight of 184.23 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane is sourced from PubChem (CID 66579448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).