About 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one
8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one (PubChem CID 66579984) has the molecular formula C18H22F3NO2
and a molecular weight of 341.37 g/mol. Its IUPAC name is 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one |
| PubChem CID | 66579984 |
| Molecular Formula | C18H22F3NO2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one |
| SMILES | O=C1N(c2ccc(CCC(F)(F)F)cc2)CCC12CCC(O)CC2 |
| InChI | InChI=1S/C18H22F3NO2/c19-18(20,21)10-5-13-1-3-14(4-2-13)22-12-11-17(16(22)24)8-6-15(23)7-9-17/h1-4,15,23H,5-12H2 |
| InChIKey | IWEXWSTXZNMESV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one?
The IUPAC name of 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one (CID 66579984) is 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one.
What is the SMILES notation for 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one?
The canonical SMILES for 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one is O=C1N(c2ccc(CCC(F)(F)F)cc2)CCC12CCC(O)CC2.
What is the InChIKey of 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one?
The InChIKey is IWEXWSTXZNMESV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F3NO2/c19-18(20,21)10-5-13-1-3-14(4-2-13)22-12-11-17(16(22)24)8-6-15(23)7-9-17/h1-4,15,23H,5-12H2.
What are the key properties of 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one?
8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one has a molecular weight of 341.37 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-2-[4-(3,3,3-trifluoropropyl)phenyl]-2-azaspiro[4.5]decan-1-one is sourced from PubChem (CID 66579984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).