C18H21N3O5S2 — CID 66580777
morpholin-4-yl-[3-(oxan-4-yl)-8,8-dioxo-8λ6,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,11-tetraen-5-yl]methanone (PubChem CID 66580777) has the molecular formula C18H21N3O5S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is morpholin-4-yl-[3-(oxan-4-yl)-8,8-dioxo-8λ6,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,11-tetraen-5-yl]methanone.
| Compound Name | morpholin-4-yl-[3-(oxan-4-yl)-8,8-dioxo-8λ6,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,11-tetraen-5-yl]methanone |
|---|---|
| PubChem CID | 66580777 |
| Molecular Formula | C18H21N3O5S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | morpholin-4-yl-[3-(oxan-4-yl)-8,8-dioxo-8λ6,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,11-tetraen-5-yl]methanone |
| SMILES | O=C(c1nn(C2CCOCC2)c2c1CS(=O)(=O)c1sccc1-2)N1CCOCC1 |
| InChI | InChI=1S/C18H21N3O5S2/c22-17(20-4-8-26-9-5-20)15-14-11-28(23,24)18-13(3-10-27-18)16(14)21(19-15)12-1-6-25-7-2-12/h3,10,12H,1-2,4-9,11H2 |
| InChIKey | HTFVOKCSBZNVCM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |