About (4-methoxycyclohexa-1,3-dien-1-yl)methanamine
(4-methoxycyclohexa-1,3-dien-1-yl)methanamine (PubChem CID 66581252) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (4-methoxycyclohexa-1,3-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (4-methoxycyclohexa-1,3-dien-1-yl)methanamine |
| PubChem CID | 66581252 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (4-methoxycyclohexa-1,3-dien-1-yl)methanamine |
| SMILES | COC1=CC=C(CN)CC1 |
| InChI | InChI=1S/C8H13NO/c1-10-8-4-2-7(6-9)3-5-8/h2,4H,3,5-6,9H2,1H3 |
| InChIKey | FJZGWNNCGLUWIO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methoxycyclohexa-1,3-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxycyclohexa-1,3-dien-1-yl)methanamine?
The IUPAC name of (4-methoxycyclohexa-1,3-dien-1-yl)methanamine (CID 66581252) is (4-methoxycyclohexa-1,3-dien-1-yl)methanamine.
What is the SMILES notation for (4-methoxycyclohexa-1,3-dien-1-yl)methanamine?
The canonical SMILES for (4-methoxycyclohexa-1,3-dien-1-yl)methanamine is COC1=CC=C(CN)CC1.
What is the InChIKey of (4-methoxycyclohexa-1,3-dien-1-yl)methanamine?
The InChIKey is FJZGWNNCGLUWIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-10-8-4-2-7(6-9)3-5-8/h2,4H,3,5-6,9H2,1H3.
What are the key properties of (4-methoxycyclohexa-1,3-dien-1-yl)methanamine?
(4-methoxycyclohexa-1,3-dien-1-yl)methanamine has a molecular weight of 139.20 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxycyclohexa-1,3-dien-1-yl)methanamine is sourced from PubChem (CID 66581252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).