C21H20F4N6O2 — CID 66581368
1-[5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 66581368) has the molecular formula C21H20F4N6O2 and a molecular weight of 464.42 g/mol. Its IUPAC name is 1-[5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-[5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 66581368 |
| Molecular Formula | C21H20F4N6O2 |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-[5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | NCCCNCc1ccc(-c2cnc(NC(=O)Nc3cc(F)c(F)cc3F)[nH]c2=O)c(F)c1 |
| InChI | InChI=1S/C21H20F4N6O2/c22-14-6-11(9-27-5-1-4-26)2-3-12(14)13-10-28-20(30-19(13)32)31-21(33)29-18-8-16(24)15(23)7-17(18)25/h2-3,6-8,10,27H,1,4-5,9,26H2,(H3,28,29,30,31,32,33) |
| InChIKey | RKAHLOFHBQICMC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|