C23H33N7O — CID 66581396
3-[4-[(3-aminopropylamino)methyl]phenyl]-6-[2-(piperidin-4-ylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one (PubChem CID 66581396) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is 3-[4-[(3-aminopropylamino)methyl]phenyl]-6-[2-(piperidin-4-ylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one.
| Compound Name | 3-[4-[(3-aminopropylamino)methyl]phenyl]-6-[2-(piperidin-4-ylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 66581396 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 3-[4-[(3-aminopropylamino)methyl]phenyl]-6-[2-(piperidin-4-ylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one |
| SMILES | NCCCNCc1ccc(-n2cc3cc(CCNC4CCNCC4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C23H33N7O/c24-9-1-10-26-15-17-2-4-21(5-3-17)30-16-18-14-20(28-22(18)29-23(30)31)8-13-27-19-6-11-25-12-7-19/h2-5,14,16,19,25-27H,1,6-13,15,24H2,(H,28,29,31) |
| InChIKey | ODROOZBCSYKDHA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|