C24H28F3N7O2 — CID 66581405
1-[5-[4-[[bis(3-aminopropyl)amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 66581405) has the molecular formula C24H28F3N7O2 and a molecular weight of 503.53 g/mol. Its IUPAC name is 1-[5-[4-[[bis(3-aminopropyl)amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-[5-[4-[[bis(3-aminopropyl)amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 66581405 |
| Molecular Formula | C24H28F3N7O2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 1-[5-[4-[[bis(3-aminopropyl)amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | NCCCN(CCCN)Cc1ccc(-c2cnc(NC(=O)Nc3cc(F)c(F)cc3F)[nH]c2=O)cc1 |
| InChI | InChI=1S/C24H28F3N7O2/c25-18-11-20(27)21(12-19(18)26)31-24(36)33-23-30-13-17(22(35)32-23)16-5-3-15(4-6-16)14-34(9-1-7-28)10-2-8-29/h3-6,11-13H,1-2,7-10,14,28-29H2,(H3,30,31,32,33,35,36) |
| InChIKey | AHGMRTHQZJYKJA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|