C22H22F3N5O3 — CID 66581413
1-[5-[4-[(4-hydroxybutylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 66581413) has the molecular formula C22H22F3N5O3 and a molecular weight of 461.44 g/mol. Its IUPAC name is 1-[5-[4-[(4-hydroxybutylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-[5-[4-[(4-hydroxybutylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 66581413 |
| Molecular Formula | C22H22F3N5O3 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 1-[5-[4-[(4-hydroxybutylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1ncc(-c2ccc(CNCCCCO)cc2)c(=O)[nH]1)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H22F3N5O3/c23-16-9-18(25)19(10-17(16)24)28-22(33)30-21-27-12-15(20(32)29-21)14-5-3-13(4-6-14)11-26-7-1-2-8-31/h3-6,9-10,12,26,31H,1-2,7-8,11H2,(H3,27,28,29,30,32,33) |
| InChIKey | UYBKLHMHYBGIOZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|