C10H18F3N3O — CID 66581418
1-methyl-3-[(2R)-2-(2,2,2-trifluoroethylamino)cyclohexyl]urea (PubChem CID 66581418) has the molecular formula C10H18F3N3O and a molecular weight of 253.27 g/mol. Its IUPAC name is 1-methyl-3-[(2R)-2-(2,2,2-trifluoroethylamino)cyclohexyl]urea.
| Compound Name | 1-methyl-3-[(2R)-2-(2,2,2-trifluoroethylamino)cyclohexyl]urea |
|---|---|
| PubChem CID | 66581418 |
| Molecular Formula | C10H18F3N3O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 1-methyl-3-[(2R)-2-(2,2,2-trifluoroethylamino)cyclohexyl]urea |
| SMILES | CNC(=O)NC1CCCC[C@H]1NCC(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O/c1-14-9(17)16-8-5-3-2-4-7(8)15-6-10(11,12)13/h7-8,15H,2-6H2,1H3,(H2,14,16,17)/t7-,8?/m1/s1 |
| InChIKey | IFQKVIOLPAKYHI-GVHYBUMESA-N |
| XLogP | 1.38 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |