C32H43FN10O2S — CID 66581609
2-[3-[3-aminopropyl-[[4-[6-[2-fluoro-4-(piperidin-4-ylsulfamoyl)phenyl]-2-methylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine (PubChem CID 66581609) has the molecular formula C32H43FN10O2S and a molecular weight of 650.83 g/mol. Its IUPAC name is 2-[3-[3-aminopropyl-[[4-[6-[2-fluoro-4-(piperidin-4-ylsulfamoyl)phenyl]-2-methylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[3-aminopropyl-[[4-[6-[2-fluoro-4-(piperidin-4-ylsulfamoyl)phenyl]-2-methylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 66581609 |
| Molecular Formula | C32H43FN10O2S |
| Molecular Weight | 650.83 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | 2-[3-[3-aminopropyl-[[4-[6-[2-fluoro-4-(piperidin-4-ylsulfamoyl)phenyl]-2-methylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine |
| SMILES | C=C1N=c2[nH]c(-c3ccc(S(=O)(=O)NC4CCNCC4)cc3F)cc2=CN1c1ccc(CN(CCCN)CCCN=C(N)N)cc1 |
| InChI | InChI=1S/C32H43FN10O2S/c1-22-39-31-24(18-30(40-31)28-9-8-27(19-29(28)33)46(44,45)41-25-10-14-37-15-11-25)21-43(22)26-6-4-23(5-7-26)20-42(16-2-12-34)17-3-13-38-32(35)36/h4-9,18-19,21,25,37,41H,1-3,10-17,20,34H2,(H,39,40)(H4,35,36,38) |
| InChIKey | NVCWFZXSQKRRFG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 183.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.83 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|