C23H32N10O — CID 66581763
3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]piperidine-1-carboximidamide (PubChem CID 66581763) has the molecular formula C23H32N10O and a molecular weight of 464.58 g/mol. Its IUPAC name is 3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]piperidine-1-carboximidamide.
| Compound Name | 3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 66581763 |
| Molecular Formula | C23H32N10O |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCCC(c2cc3cn(-c4ccc(CNCCCN=C(N)N)cc4)c(=O)nc3[nH]2)C1 |
| InChI | InChI=1S/C23H32N10O/c24-21(25)29-9-2-8-28-12-15-4-6-18(7-5-15)33-14-17-11-19(30-20(17)31-23(33)34)16-3-1-10-32(13-16)22(26)27/h4-7,11,14,16,28H,1-3,8-10,12-13H2,(H3,26,27)(H4,24,25,29)(H,30,31,34) |
| InChIKey | UEUAFLLMXTUVEF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 180.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|