About 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine
2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 66581825) has the molecular formula C17H20N6O2
and a molecular weight of 340.39 g/mol. Its IUPAC name is 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine.
Molecular Properties
| Compound Name | 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
| PubChem CID | 66581825 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(-n2cc3ccoc3nc2=O)cc1 |
| InChI | InChI=1S/C17H20N6O2/c18-16(19)21-8-1-7-20-10-12-2-4-14(5-3-12)23-11-13-6-9-25-15(13)22-17(23)24/h2-6,9,11,20H,1,7-8,10H2,(H4,18,19,21) |
| InChIKey | DMQYSQNZBWLONO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 124.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine?
The IUPAC name of 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine (CID 66581825) is 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine.
What is the SMILES notation for 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine?
The canonical SMILES for 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine is NC(N)=NCCCNCc1ccc(-n2cc3ccoc3nc2=O)cc1.
What is the InChIKey of 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine?
The InChIKey is DMQYSQNZBWLONO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N6O2/c18-16(19)21-8-1-7-20-10-12-2-4-14(5-3-12)23-11-13-6-9-25-15(13)22-17(23)24/h2-6,9,11,20H,1,7-8,10H2,(H4,18,19,21).
What are the key properties of 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine?
2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine has a molecular weight of 340.39 g/mol, XLogP of 0.73, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[[4-(2-oxofuro[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine is sourced from PubChem (CID 66581825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).