C21H28N8O2 — CID 66581891
2-[3-[[4-(6-morpholin-2-yl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 66581891) has the molecular formula C21H28N8O2 and a molecular weight of 424.51 g/mol. Its IUPAC name is 2-[3-[[4-(6-morpholin-2-yl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-(6-morpholin-2-yl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 66581891 |
| Molecular Formula | C21H28N8O2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 2-[3-[[4-(6-morpholin-2-yl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(-n2cc3cc(C4CNCCO4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C21H28N8O2/c22-20(23)26-7-1-6-24-11-14-2-4-16(5-3-14)29-13-15-10-17(18-12-25-8-9-31-18)27-19(15)28-21(29)30/h2-5,10,13,18,24-25H,1,6-9,11-12H2,(H4,22,23,26)(H,27,28,30) |
| InChIKey | FYZCYSAFIOZGBS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 148.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|