C25H35FN8O — CID 66581903
2-[3-[[4-[6-[1-(3-fluoropropyl)piperidin-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 66581903) has the molecular formula C25H35FN8O and a molecular weight of 482.61 g/mol. Its IUPAC name is 2-[3-[[4-[6-[1-(3-fluoropropyl)piperidin-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[1-(3-fluoropropyl)piperidin-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 66581903 |
| Molecular Formula | C25H35FN8O |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 2-[3-[[4-[6-[1-(3-fluoropropyl)piperidin-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(-n2cc3cc(C4CCCN(CCCF)C4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C25H35FN8O/c26-9-2-13-33-12-1-4-19(16-33)22-14-20-17-34(25(35)32-23(20)31-22)21-7-5-18(6-8-21)15-29-10-3-11-30-24(27)28/h5-8,14,17,19,29H,1-4,9-13,15-16H2,(H4,27,28,30)(H,31,32,35) |
| InChIKey | PCGVGKOIINUQCA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|