About 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol
2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol (PubChem CID 66582314) has the molecular formula C19H21F3N2O3S
and a molecular weight of 414.45 g/mol. Its IUPAC name is 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol |
| PubChem CID | 66582314 |
| Molecular Formula | C19H21F3N2O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol |
| SMILES | O=S(=O)(c1ccccc1)N1CCN(c2ccc(C(O)(CF)C(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H21F3N2O3S/c20-14-19(25,18(21)22)15-6-8-16(9-7-15)23-10-12-24(13-11-23)28(26,27)17-4-2-1-3-5-17/h1-9,18,25H,10-14H2 |
| InChIKey | NRENCIXGDDSNEW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol?
The IUPAC name of 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol (CID 66582314) is 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol.
What is the SMILES notation for 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol?
The canonical SMILES for 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol is O=S(=O)(c1ccccc1)N1CCN(c2ccc(C(O)(CF)C(F)F)cc2)CC1.
What is the InChIKey of 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol?
The InChIKey is NRENCIXGDDSNEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3N2O3S/c20-14-19(25,18(21)22)15-6-8-16(9-7-15)23-10-12-24(13-11-23)28(26,27)17-4-2-1-3-5-17/h1-9,18,25H,10-14H2.
What are the key properties of 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol?
2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol has a molecular weight of 414.45 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(benzenesulfonyl)piperazin-1-yl]phenyl]-1,1,3-trifluoropropan-2-ol is sourced from PubChem (CID 66582314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).