C24H31F3N4O4S — CID 66582318
2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-(oxan-4-ylmethyl)piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 66582318) has the molecular formula C24H31F3N4O4S and a molecular weight of 528.60 g/mol. Its IUPAC name is 2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-(oxan-4-ylmethyl)piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-(oxan-4-ylmethyl)piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 66582318 |
| Molecular Formula | C24H31F3N4O4S |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-(oxan-4-ylmethyl)piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc(N2CCN(S(=O)(=O)c3ccc(N)nc3)C[C@@H]2CC2CCOCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H31F3N4O4S/c1-23(32,24(25,26)27)18-2-4-19(5-3-18)31-11-10-30(16-20(31)14-17-8-12-35-13-9-17)36(33,34)21-6-7-22(28)29-15-21/h2-7,15,17,20,32H,8-14,16H2,1H3,(H2,28,29)/t20-,23?/m0/s1 |
| InChIKey | UVNIGCUQKUJRSU-AJZOCDQUSA-N |
| XLogP | 3.13 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|