About 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene
2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene (PubChem CID 66582375) has the molecular formula C22H24BrF3O
and a molecular weight of 441.33 g/mol. Its IUPAC name is 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene.
Molecular Properties
| Compound Name | 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene |
| PubChem CID | 66582375 |
| Molecular Formula | C22H24BrF3O |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene |
| SMILES | FCC1(CF)CCC(COc2ccc(Cc3cc(Br)ccc3F)cc2)CC1 |
| InChI | InChI=1S/C22H24BrF3O/c23-19-3-6-21(26)18(12-19)11-16-1-4-20(5-2-16)27-13-17-7-9-22(14-24,15-25)10-8-17/h1-6,12,17H,7-11,13-15H2 |
| InChIKey | UUBWCRXORNPIKZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene?
The IUPAC name of 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene (CID 66582375) is 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene.
What is the SMILES notation for 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene?
The canonical SMILES for 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene is FCC1(CF)CCC(COc2ccc(Cc3cc(Br)ccc3F)cc2)CC1.
What is the InChIKey of 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene?
The InChIKey is UUBWCRXORNPIKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24BrF3O/c23-19-3-6-21(26)18(12-19)11-16-1-4-20(5-2-16)27-13-17-7-9-22(14-24,15-25)10-8-17/h1-6,12,17H,7-11,13-15H2.
What are the key properties of 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene?
2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene has a molecular weight of 441.33 g/mol, XLogP of 6.67, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-bromo-1-fluorobenzene is sourced from PubChem (CID 66582375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).