C24H30F3N3O4S2 — CID 66582383
2-[4-[(2S)-2-(2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 66582383) has the molecular formula C24H30F3N3O4S2 and a molecular weight of 545.65 g/mol. Its IUPAC name is 2-[4-[(2S)-2-(2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-[(2S)-2-(2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 66582383 |
| Molecular Formula | C24H30F3N3O4S2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 2-[4-[(2S)-2-(2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2CN2CC3CCOC3C2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H30F3N3O4S2/c1-23(31,24(25,26)27)18-4-6-19(7-5-18)30-10-9-29(36(32,33)22-3-2-12-35-22)15-20(30)14-28-13-17-8-11-34-21(17)16-28/h2-7,12,17,20-21,31H,8-11,13-16H2,1H3/t17?,20-,21?,23?/m0/s1 |
| InChIKey | UZDYZEIMVZIANF-GRHAEPRWSA-N |
| XLogP | 3.12 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|