C20H23F3N2O3S — CID 66582409
2-[4-[(2S)-4-(benzenesulfonyl)-2-methylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 66582409) has the molecular formula C20H23F3N2O3S and a molecular weight of 428.48 g/mol. Its IUPAC name is 2-[4-[(2S)-4-(benzenesulfonyl)-2-methylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-[(2S)-4-(benzenesulfonyl)-2-methylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 66582409 |
| Molecular Formula | C20H23F3N2O3S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-[4-[(2S)-4-(benzenesulfonyl)-2-methylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccccc2)CCN1c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3N2O3S/c1-15-14-24(29(27,28)18-6-4-3-5-7-18)12-13-25(15)17-10-8-16(9-11-17)19(2,26)20(21,22)23/h3-11,15,26H,12-14H2,1-2H3/t15-,19?/m0/s1 |
| InChIKey | PVZTUKLIPRHHTC-FUKCDUGKSA-N |
| XLogP | 3.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|