C25H31F3N2O4S — CID 66582493
2-[4-[(2R)-4-(benzenesulfonyl)-2-(oxan-4-ylmethyl)piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 66582493) has the molecular formula C25H31F3N2O4S and a molecular weight of 512.59 g/mol. Its IUPAC name is 2-[4-[(2R)-4-(benzenesulfonyl)-2-(oxan-4-ylmethyl)piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-[(2R)-4-(benzenesulfonyl)-2-(oxan-4-ylmethyl)piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 66582493 |
| Molecular Formula | C25H31F3N2O4S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 2-[4-[(2R)-4-(benzenesulfonyl)-2-(oxan-4-ylmethyl)piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc(N2CCN(S(=O)(=O)c3ccccc3)C[C@H]2CC2CCOCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H31F3N2O4S/c1-24(31,25(26,27)28)20-7-9-21(10-8-20)30-14-13-29(35(32,33)23-5-3-2-4-6-23)18-22(30)17-19-11-15-34-16-12-19/h2-10,19,22,31H,11-18H2,1H3/t22-,24?/m1/s1 |
| InChIKey | BBJFQVWXESGMJT-LETIRJCYSA-N |
| XLogP | 4.15 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|