C18H21F3N4O3S — CID 66582554
(2S)-2-[4-[4-[(6-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 66582554) has the molecular formula C18H21F3N4O3S and a molecular weight of 430.45 g/mol. Its IUPAC name is (2S)-2-[4-[4-[(6-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-2-[4-[4-[(6-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 66582554 |
| Molecular Formula | C18H21F3N4O3S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | (2S)-2-[4-[4-[(6-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | C[C@](O)(c1ccc(N2CCN(S(=O)(=O)c3ccc(N)nc3)CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H21F3N4O3S/c1-17(26,18(19,20)21)13-2-4-14(5-3-13)24-8-10-25(11-9-24)29(27,28)15-6-7-16(22)23-12-15/h2-7,12,26H,8-11H2,1H3,(H2,22,23)/t17-/m0/s1 |
| InChIKey | IMIZVELSXSSHES-KRWDZBQOSA-N |
| XLogP | 1.94 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|