C9H8BrF3O2 — CID 66582585
2-(4-bromophenyl)-3,3,3-trifluoropropane-1,2-diol (PubChem CID 66582585) has the molecular formula C9H8BrF3O2 and a molecular weight of 285.06 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3,3,3-trifluoropropane-1,2-diol.
| Compound Name | 2-(4-bromophenyl)-3,3,3-trifluoropropane-1,2-diol |
|---|---|
| PubChem CID | 66582585 |
| Molecular Formula | C9H8BrF3O2 |
| Molecular Weight | 285.06 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 2-(4-bromophenyl)-3,3,3-trifluoropropane-1,2-diol |
| SMILES | OCC(O)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H8BrF3O2/c10-7-3-1-6(2-4-7)8(15,5-14)9(11,12)13/h1-4,14-15H,5H2 |
| InChIKey | QQAGDRREPSCFLE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.06 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |