About ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate
ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate (PubChem CID 66582633) has the molecular formula C18H35N3O4
and a molecular weight of 357.50 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate |
| PubChem CID | 66582633 |
| Molecular Formula | C18H35N3O4 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.26 |
| IUPAC Name | ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate |
| SMILES | CC(C)NC[C@H]1CN(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35N3O4/c1-13(2)19-11-14-12-20(15(22)24-17(3,4)5)9-10-21(14)16(23)25-18(6,7)8/h13-14,19H,9-12H2,1-8H3/t14-/m0/s1 |
| InChIKey | SJJNLLPTZLMIOW-AWEZNQCLSA-N |
| XLogP | 2.84 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate?
The IUPAC name of ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate (CID 66582633) is ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate.
What is the SMILES notation for ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate?
The canonical SMILES for ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate is CC(C)NC[C@H]1CN(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate?
The InChIKey is SJJNLLPTZLMIOW-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H35N3O4/c1-13(2)19-11-14-12-20(15(22)24-17(3,4)5)9-10-21(14)16(23)25-18(6,7)8/h13-14,19H,9-12H2,1-8H3/t14-/m0/s1.
What are the key properties of ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate?
ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate has a molecular weight of 357.50 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2S)-2-[(propan-2-ylamino)methyl]piperazine-1,4-dicarboxylate is sourced from PubChem (CID 66582633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).