C23H29F3N2O4S2 — CID 66583091
(2S)-1,1,1-trifluoro-2-[4-[(2S)-2-(oxan-4-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 66583091) has the molecular formula C23H29F3N2O4S2 and a molecular weight of 518.62 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-2-[4-[(2S)-2-(oxan-4-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-2-[4-[(2S)-2-(oxan-4-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 66583091 |
| Molecular Formula | C23H29F3N2O4S2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | (2S)-1,1,1-trifluoro-2-[4-[(2S)-2-(oxan-4-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@](O)(c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2CC2CCOCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H29F3N2O4S2/c1-22(29,23(24,25)26)18-4-6-19(7-5-18)28-11-10-27(34(30,31)21-3-2-14-33-21)16-20(28)15-17-8-12-32-13-9-17/h2-7,14,17,20,29H,8-13,15-16H2,1H3/t20-,22-/m0/s1 |
| InChIKey | XYVKOMVNXJFBFF-UNMCSNQZSA-N |
| XLogP | 4.21 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|