C25H42N4O6Si — CID 66583384
2-methoxyethyl 1-(2-methoxyethoxy)-4-[7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate (PubChem CID 66583384) has the molecular formula C25H42N4O6Si and a molecular weight of 522.72 g/mol. Its IUPAC name is 2-methoxyethyl 1-(2-methoxyethoxy)-4-[7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate.
| Compound Name | 2-methoxyethyl 1-(2-methoxyethoxy)-4-[7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66583384 |
| Molecular Formula | C25H42N4O6Si |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 2-methoxyethyl 1-(2-methoxyethoxy)-4-[7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate |
| SMILES | COCCOC(=O)C1(OCCOC)CCC(c2cc(NCOCC[Si](C)(C)C)n3nccc3n2)CC1 |
| InChI | InChI=1S/C25H42N4O6Si/c1-31-12-14-34-24(30)25(35-15-13-32-2)9-6-20(7-10-25)21-18-23(29-22(28-21)8-11-27-29)26-19-33-16-17-36(3,4)5/h8,11,18,20,26H,6-7,9-10,12-17,19H2,1-5H3 |
| InChIKey | NAVMULNUQYIPDL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|