C33H49NO2 — CID 66583430
(6aS,6bR,8aS,11R,12aR,14aR)-4,6a,6b,8a,11,14a-hexamethyl-11-(pyrrolidin-1-ylmethyl)-7,8,9,10,12,12a,13,14-octahydro-6aH-picene-2,3-diol (PubChem CID 66583430) has the molecular formula C33H49NO2 and a molecular weight of 491.76 g/mol. Its IUPAC name is (6aS,6bR,8aS,11R,12aR,14aR)-4,6a,6b,8a,11,14a-hexamethyl-11-(pyrrolidin-1-ylmethyl)-7,8,9,10,12,12a,13,14-octahydro-6aH-picene-2,3-diol.
| Compound Name | (6aS,6bR,8aS,11R,12aR,14aR)-4,6a,6b,8a,11,14a-hexamethyl-11-(pyrrolidin-1-ylmethyl)-7,8,9,10,12,12a,13,14-octahydro-6aH-picene-2,3-diol |
|---|---|
| PubChem CID | 66583430 |
| Molecular Formula | C33H49NO2 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.38 |
| IUPAC Name | (6aS,6bR,8aS,11R,12aR,14aR)-4,6a,6b,8a,11,14a-hexamethyl-11-(pyrrolidin-1-ylmethyl)-7,8,9,10,12,12a,13,14-octahydro-6aH-picene-2,3-diol |
| SMILES | Cc1c(O)c(O)cc2c1C=CC1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(CN4CCCC4)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C33H49NO2/c1-22-23-9-10-26-31(4,24(23)19-25(35)28(22)36)14-16-33(6)27-20-29(2,21-34-17-7-8-18-34)11-12-30(27,3)13-15-32(26,33)5/h9-10,19,26-27,35-36H,7-8,11-18,20-21H2,1-6H3/t26?,27-,29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | BCGKBAZPJHRTKF-VNQUGBBCSA-N |
| XLogP | 7.82 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|