C21H21N7O2 — CID 66583455
N-(4-ethoxyphenyl)-8-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (PubChem CID 66583455) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-8-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine.
| Compound Name | N-(4-ethoxyphenyl)-8-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
|---|---|
| PubChem CID | 66583455 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-(4-ethoxyphenyl)-8-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| SMILES | CCOc1ccc(Nc2nc3c(-c4cnc5c(c4)OCCN5C)nccn3n2)cc1 |
| InChI | InChI=1S/C21H21N7O2/c1-3-29-16-6-4-15(5-7-16)24-21-25-20-18(22-8-9-28(20)26-21)14-12-17-19(23-13-14)27(2)10-11-30-17/h4-9,12-13H,3,10-11H2,1-2H3,(H,24,26) |
| InChIKey | BNZHLEMGWACVIX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |