C38H55N5O5Si2 — CID 66583471
methyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-hydroxycyclohexyl]acetate (PubChem CID 66583471) has the molecular formula C38H55N5O5Si2 and a molecular weight of 718.06 g/mol. Its IUPAC name is methyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-hydroxycyclohexyl]acetate.
| Compound Name | methyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-hydroxycyclohexyl]acetate |
|---|---|
| PubChem CID | 66583471 |
| Molecular Formula | C38H55N5O5Si2 |
| Molecular Weight | 718.06 g/mol |
| Exact Mass | 717.37 |
| IUPAC Name | methyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-hydroxycyclohexyl]acetate |
| SMILES | COC(=O)CC1(O)CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc(-c5ccccc5)nc4)c3n2)CC1 |
| InChI | InChI=1S/C38H55N5O5Si2/c1-46-36(44)24-38(45)17-15-30(16-18-38)34-23-35(42(27-47-19-21-49(2,3)4)28-48-20-22-50(5,6)7)43-37(41-34)32(26-40-43)31-13-14-33(39-25-31)29-11-9-8-10-12-29/h8-14,23,25-26,30,45H,15-22,24,27-28H2,1-7H3 |
| InChIKey | WKQXRKVCDYXEKL-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.06 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|